CymitQuimica logo

CAS 1260902-01-9

:

6-(Difluoromethyl)-1,2-dihydro-2-oxo-5-pyrimidinecarboxylic acid

Description:
6-(Difluoromethyl)-1,2-dihydro-2-oxo-5-pyrimidinecarboxylic acid is a pyrimidine derivative characterized by the presence of a difluoromethyl group and a carboxylic acid functional group. This compound features a bicyclic structure that includes a pyrimidine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The difluoromethyl group contributes to its unique reactivity and potential biological activity, as fluorinated compounds often exhibit altered pharmacokinetic properties. The carboxylic acid moiety enhances its solubility in polar solvents and may influence its interaction with biological targets. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could lead to specific biological activities. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties can be further explored through various analytical methods such as NMR, mass spectrometry, and IR spectroscopy.
Formula:C6H4F2N2O3
InChI:InChI=1S/C6H4F2N2O3/c7-4(8)3-2(5(11)12)1-9-6(13)10-3/h1,4H,(H,11,12)(H,9,10,13)
InChI key:InChIKey=MGSVVLOYKLDYKS-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C(F)F)NC(=O)N=C1
Synonyms:
  • 6-(Difluoromethyl)-1,2-dihydro-2-oxo-5-pyrimidinecarboxylic acid
  • 5-Pyrimidinecarboxylic acid, 6-(difluoromethyl)-1,2-dihydro-2-oxo-
  • 4-Difluoromethyl-2-hydroxypyrimidine-5-carboxylic acid
Found 2 products.