CAS 1263420-68-3

Benzamide, N-cyclopropyl-4-[8-[(2-methylpropyl)amino]imidazo[1,2-a]pyrazin-3-yl]-

Description:

Benzamide, N-cyclopropyl-4-[8-[(2-methylpropyl)amino]imidazo[1,2-a]pyrazin-3-yl]- is a chemical compound characterized by its complex structure, which includes a benzamide moiety and an imidazo[1,2-a]pyrazine ring. This compound features a cyclopropyl group and a 2-methylpropyl amino substituent, contributing to its unique properties. It is typically classified as a small organic molecule and may exhibit biological activity, potentially serving as a pharmacological agent. The presence of nitrogen-containing heterocycles suggests that it may interact with biological targets, possibly influencing various signaling pathways. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of functional groups. As with many compounds in medicinal chemistry, understanding its structure-activity relationship is crucial for evaluating its potential therapeutic applications. Safety and handling considerations are important, as with any chemical substance, and appropriate measures should be taken when working with it in a laboratory setting.

Formula: C₂₀H₂₃N₅O

InChI: InChI=1S/C20H23N5O/c1-13(2)11-22-18-19-23-12-17(25(19)10-9-21-18)14-3-5-15(6-4-14)20(26)24-16-7-8-16/h3-6,9-10,12-13,16H,7-8,11H2,1-2H3,(H,21,22)(H,24,26)

InChI key: QTOFVYOMOKYCEQ-UHFFFAOYSA-N

SMILES: CC(C)CNC1=NC=CN2C1=NC=C2C3=CC=C(C=C3)C(=O)NC4CC4

Synonyms:

• Mps-BAY2b
• Benzamide, N-cyclopropyl-4-[8-[(2-methylpropyl)amino]imidazo[1,2-a]pyrazin-3-yl]-

Mps-BAY2b

CAS: 1263420-68-3

Mps-BAY2b is a novel MPS1 inhibitor.

Formula: C₂₀H₂₃N₅O

Color and Shape: Solid

Molecular weight: 349.43

Ref: TM-T28091