CymitQuimica logo

CAS 1263506-20-2

:

tert-butyl 3-(hydroxymethyl)-3-methylpyrrolidine-1-carboxylate

Description:
Tert-butyl 3-(hydroxymethyl)-3-methylpyrrolidine-1-carboxylate is a chemical compound characterized by its pyrrolidine structure, which features a five-membered ring containing nitrogen. This compound includes a tert-butyl group, contributing to its hydrophobic characteristics, and a hydroxymethyl group that enhances its reactivity and potential for hydrogen bonding. The presence of the carboxylate functional group indicates that it can participate in various chemical reactions, such as esterification or amidation. Its molecular structure suggests it may exhibit properties typical of both amines and carboxylic acids, making it versatile in synthetic applications. The compound is likely to be soluble in organic solvents due to its hydrophobic tert-butyl group, while the hydroxymethyl and carboxylate functionalities may impart some degree of polarity. Additionally, its potential applications could span pharmaceuticals, agrochemicals, or as a building block in organic synthesis, although specific applications would depend on further research and development. Safety and handling precautions should be observed, as with any chemical substance, due to potential reactivity and toxicity.
Formula:C11H21NO3
InChI:InChI=1S/C11H21NO3/c1-10(2,3)15-9(14)12-6-5-11(4,7-12)8-13/h13H,5-8H2,1-4H3
InChI key:OMMHAHKCMUUEOY-UHFFFAOYSA-N
SMILES:CC1(CCN(C1)C(=O)OC(C)(C)C)CO
Found 5 products.