CAS 1263629-39-5

2H-Pyrido[1,2-a]pyrimidinium, 1-[(2-chloro-5-thiazolyl)methyl]-3-(3,5-dichlorophenyl)-3,4-dihydro-9-methyl-2,4-dioxo-, inner salt

Description:

2H-Pyrido[1,2-a]pyrimidinium, 1-[(2-chloro-5-thiazolyl)methyl]-3-(3,5-dichlorophenyl)-3,4-dihydro-9-methyl-2,4-dioxo-, inner salt, identified by CAS number 1263629-39-5, is a complex organic compound characterized by its unique structural features, including a pyrido-pyrimidine core and various substituents that contribute to its chemical properties. The presence of a thiazole ring and multiple chlorine atoms suggests potential biological activity, possibly influencing its reactivity and solubility. This compound may exhibit properties typical of heterocyclic compounds, such as potential pharmacological effects, due to the presence of nitrogen and sulfur in its structure. Its inner salt formation indicates that it may exist in a protonated state, which can affect its stability and interaction with other molecules. The specific arrangement of functional groups and the overall molecular geometry are crucial for understanding its reactivity and potential applications in medicinal chemistry or material science. Further studies would be necessary to elucidate its full range of properties and potential uses.

Formula: C₁₉H₁₂Cl₃N₃O₂S

InChI: InChI=1S/C19H12Cl3N3O2S/c1-10-3-2-4-24-16(10)25(9-14-8-23-19(22)28-14)18(27)15(17(24)26)11-5-12(20)7-13(21)6-11/h2-8H,9H2,1H3

InChI key: PVDQXPBKBSCNJZ-UHFFFAOYSA-N

SMILES: CC1=CC=CN2C1=[N+](C(=C(C2=O)C3=CC(=CC(=C3)Cl)Cl)[O-])CC4=CN=C(S4)Cl

Synonyms:

• Dicloromezotiaz
• 2H-Pyrido[1,2-a]pyrimidinium, 1-[(2-chloro-5-thiazolyl)methyl]-3-(3,5-dichlorophenyl)-3,4-dihydro-9-methyl-2,4-dioxo-, inner salt

Dicloromezotiaz

CAS: 1263629-39-5

Dicloromezotiaz: Potent insecticide targeting nAChRs, controls various lepidoptera.

Formula: C₁₉H₁₂Cl₃N₃O₂S

Color and Shape: Solid

Molecular weight: 452.74

Ref: TM-T74395

Dicloromezotiaz

CAS: 1263629-39-5

Formula: C₁₉H₁₂Cl₃N₃O₂S

Color and Shape: Neat

Molecular weight: 452.74

Ref: 04-C12560200

Dicloromezotiaz

Controlled Product

CAS: 1263629-39-5

Formula: C₁₉H₁₂Cl₃N₃O₂S

Color and Shape: Neat

Molecular weight: 452.74

Ref: TR-D434402