CymitQuimica logo

CAS 12650-88-3

:

lysozyme from human neutrophils

Description:
Lysozyme from human neutrophils, identified by the CAS number 12650-88-3, is an enzyme that plays a crucial role in the immune response. It is a type of glycoside hydrolase, primarily involved in breaking down bacterial cell walls by hydrolyzing the glycosidic bonds in peptidoglycan, a key component of bacterial cell structure. This enzyme exhibits antibacterial properties, contributing to the innate immune defense by lysing various Gram-positive bacteria. Lysozyme is characterized by its relatively small size and is typically found in various bodily fluids, including saliva, tears, and neutrophil granules. It has a well-defined three-dimensional structure, which is essential for its enzymatic activity, and operates optimally at a specific pH range. Additionally, lysozyme has been studied for its potential therapeutic applications, including its use as an antimicrobial agent in food preservation and pharmaceuticals. Its stability and activity can be influenced by factors such as temperature, pH, and the presence of inhibitors or activators.
Formula:C36H61N7O19
InChI:InChI=1S/C99H159N37O23/c1-11-50(8)77(132-72(139)46-120-81(145)63(32-33-70(101)137)124-88(152)69-31-21-39-136(69)93(157)68(43-73(140)141)131-84(148)62(29-19-37-116-98(109)110)125-90(154)75(48(4)5)135-91(155)76(49(6)7)133-80(144)57(100)24-16-34-113-95(103)104)92(156)126-60(27-17-35-114-96(105)106)82(146)121-51(9)78(142)129-66(41-54-45-119-59-26-15-13-23-56(54)59)87(151)134-74(47(2)3)89(153)122-52(10)79(143)128-65(40-53-44-118-58-25-14-12-22-55(53)58)85(149)123-61(28-18-36-115-97(107)108)83(147)130-67(42-71(102)138)86(150)127-64(94(158)159)30-20-38-117-99(111)112/h12-15,22-23,25-26,44-45,47-52,57,60-69,74-77,118-119H,11,16-21,24,27-43,46,100H2,1-10H3,(H2,101,137)(H2,102,138)(H,120,145)(H,121,146)(H,122,153)(H,123,149)(H,124,152)(H,125,154)(H,126,156)(H,127,150)(H,128,143)(H,129,142)(H,130,147)(H,131,148)(H,132,139)(H,133,144)(H,134,151)(H,135,155)(H,140,141)(H,158,159)(H4,103,104,113)(H4,105,106,114)(H4,107,108,115)(H4,109,110,116)(H4,111,112,117)
InChI key:ZJCXKXFAOCLSRV-UHFFFAOYSA-N
SMILES:CCC(C)C(C(=O)NC(CCCNC(=N)N)C(=O)NC(C)C(=O)NC(CC1=CNC2=CC=CC=C21)C(=O)NC(C(C)C)C(=O)NC(C)C(=O)NC(CC3=CNC4=CC=CC=C43)C(=O)NC(CCCNC(=N)N)C(=O)NC(CC(=O)N)C(=O)NC(CCCNC(=N)N)C(=O)O)NC(=O)CNC(=O)C(CCC(=O)N)NC(=O)C5CCCN5C(=O)C(CC(=O)O)NC(=O)C(CCCNC(=N)N)NC(=O)C(C(C)C)NC(=O)C(C(C)C)NC(=O)C(CCCNC(=N)N)N
Synonyms:
  • Lysosyme Chloride
  • Lysozyme, Human Neutrophil
  • Mucopeptide
  • Lysozyme (hen egg white)
  • Lysozyme
Found 11 products.