CAS 126674-93-9

4,6-DIFLUOROINDOLINE-2,3-DIONE

Description:

4,6-Difluoroindoline-2,3-dione, with the CAS number 126674-93-9, is a synthetic organic compound characterized by its indoline structure, which features a fused bicyclic system containing both a benzene and a pyrrole ring. The presence of two fluorine atoms at the 4 and 6 positions of the indoline moiety significantly influences its chemical properties, including its reactivity and polarity. This compound typically exhibits a solid state at room temperature and is soluble in various organic solvents. Its unique structure makes it of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to potential biological activity. The dione functional groups contribute to its ability to participate in various chemical reactions, including nucleophilic additions and cycloadditions. Additionally, the fluorine substituents can enhance metabolic stability and alter the lipophilicity of the compound, which is crucial for drug design. Overall, 4,6-difluoroindoline-2,3-dione serves as a valuable building block in organic synthesis and medicinal applications.

Formula: C₈H₃F₂NO₂

InChI: InChI=1/C8H3F2NO2/c9-3-1-4(10)6-5(2-3)11-8(13)7(6)12/h1-2H,(H,11,12,13)

SMILES: C1=C(C=C2C(=C1F)C(=O)C(=O)N2)F

Synonyms:

• Buttpark 50\07-84
• 4,6-Difluoroisatin

1H-Indole-2,3-dione, 4,6-difluoro-

CAS: 126674-93-9

Formula: C₈H₃F₂NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 183.1117

Ref: IN-DA000T34

4,6-Difluoro-1H-indole-2,3-dione

CAS: 126674-93-9

4,6-Difluoro-1H-indole-2,3-dione

Purity: 97%

Molecular weight: 183.11172g/mol

Ref: 54-PC900686

4,6-Difluoroisatin

CAS: 126674-93-9

4,6-Difluoroisatin is a chemical that is useful in the synthesis of complex compounds. It has been used as a reagent for the preparation of 4,6-difluoropyridinium salts and as a reaction component in the synthesis of polymers. 4,6-Difluoroisatin is also one of the building blocks in the synthesis of a number of other compounds. This chemical has been shown to be an effective scaffold for peptides and proteins.

Formula: C₈H₃F₂NO₂

Purity: Min. 95%

Molecular weight: 183.11 g/mol

Ref: 3D-FD34228

4,6-Difluoro-1H-indole-2,3-dione

CAS: 126674-93-9

Formula: C₈H₃F₂NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 183.114

Ref: 10-F068799