CAS 126674-93-9
:4,6-DIFLUOROINDOLINE-2,3-DIONE
Description:
4,6-Difluoroindoline-2,3-dione, with the CAS number 126674-93-9, is a synthetic organic compound characterized by its indoline structure, which features a fused bicyclic system containing both a benzene and a pyrrole ring. The presence of two fluorine atoms at the 4 and 6 positions of the indoline moiety significantly influences its chemical properties, including its reactivity and polarity. This compound typically exhibits a solid state at room temperature and is soluble in various organic solvents. Its unique structure makes it of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to potential biological activity. The dione functional groups contribute to its ability to participate in various chemical reactions, including nucleophilic additions and cycloadditions. Additionally, the fluorine substituents can enhance metabolic stability and alter the lipophilicity of the compound, which is crucial for drug design. Overall, 4,6-difluoroindoline-2,3-dione serves as a valuable building block in organic synthesis and medicinal applications.
Formula:C8H3F2NO2
InChI:InChI=1/C8H3F2NO2/c9-3-1-4(10)6-5(2-3)11-8(13)7(6)12/h1-2H,(H,11,12,13)
SMILES:C1=C(C=C2C(=C1F)C(=O)C(=O)N2)F
Synonyms:- Buttpark 50\07-84
- 4,6-Difluoroisatin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4,6-Difluoroisatin
CAS:4,6-Difluoro-1H-indole-2,3-dioneFormula:C8H3F2NO2Purity:95%Molecular weight:183.114,6-Difluoro-1H-indole-2,3-dione
CAS:4,6-Difluoro-1H-indole-2,3-dioneFormula:C8H3F2NO2Purity:97%Molecular weight:183.111721H-Indole-2,3-dione, 4,6-difluoro-
CAS:Formula:C8H3F2NO2Purity:95%Color and Shape:SolidMolecular weight:183.11174,6-Difluoroisatin
CAS:4,6-Difluoroisatin is a chemical that is useful in the synthesis of complex compounds. It has been used as a reagent for the preparation of 4,6-difluoropyridinium salts and as a reaction component in the synthesis of polymers. 4,6-Difluoroisatin is also one of the building blocks in the synthesis of a number of other compounds. This chemical has been shown to be an effective scaffold for peptides and proteins.Formula:C8H3F2NO2Purity:Min. 95%Molecular weight:183.11 g/mol4,6-Difluoro-1H-indole-2,3-dione
CAS:Formula:C8H3F2NO2Purity:95%Color and Shape:SolidMolecular weight:183.114




