CymitQuimica logo

CAS 126674-93-9

:

4,6-DIFLUOROINDOLINE-2,3-DIONE

Description:
4,6-Difluoroindoline-2,3-dione, with the CAS number 126674-93-9, is a synthetic organic compound characterized by its indoline structure, which features a fused bicyclic system containing both a benzene and a pyrrole ring. The presence of two fluorine atoms at the 4 and 6 positions of the indoline moiety significantly influences its chemical properties, including its reactivity and polarity. This compound typically exhibits a solid state at room temperature and is soluble in various organic solvents. Its unique structure makes it of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to potential biological activity. The dione functional groups contribute to its ability to participate in various chemical reactions, including nucleophilic additions and cycloadditions. Additionally, the fluorine substituents can enhance metabolic stability and alter the lipophilicity of the compound, which is crucial for drug design. Overall, 4,6-difluoroindoline-2,3-dione serves as a valuable building block in organic synthesis and medicinal applications.
Formula:C8H3F2NO2
InChI:InChI=1/C8H3F2NO2/c9-3-1-4(10)6-5(2-3)11-8(13)7(6)12/h1-2H,(H,11,12,13)
InChI key:YIVXDNUTNIKQMY-UHFFFAOYSA-N
SMILES:C1=C(C=C2C(=C1F)C(=O)C(=O)N2)F
Synonyms:
  • Buttpark 50\07-84
  • 4,6-Difluoroisatin
Found 4 products.