CymitQuimica logo

CAS 126712-07-0

:

3-Bromo-2-formylanisole

Description:
3-Bromo-2-formylanisole is an organic compound characterized by the presence of a bromine atom, a formyl group, and a methoxy group attached to a benzene ring. Its molecular structure features a bromine substituent at the 3-position and a formyl group at the 2-position relative to the methoxy group. This compound is typically a pale yellow to brown liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents such as ethanol and dichloromethane but has limited solubility in water due to its hydrophobic aromatic structure. 3-Bromo-2-formylanisole is of interest in organic synthesis and may serve as an intermediate in the production of pharmaceuticals, agrochemicals, or other fine chemicals. Its reactivity is influenced by the electron-withdrawing nature of the formyl group and the electron-donating properties of the methoxy group, making it a versatile building block in various chemical reactions, including nucleophilic substitutions and coupling reactions. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C8H7BrO2
InChI:InChI=1S/C8H7BrO2/c1-11-8-4-2-3-7(9)6(8)5-10/h2-5H,1H3
InChI key:RQLOLSOZFHENIV-UHFFFAOYSA-N
SMILES:COC1=C(C(=CC=C1)Br)C=O
Found 4 products.