CAS 126828-32-8
:L-Alanyl-L-histidyl-L-lysine
Description:
L-Alanyl-L-histidyl-L-lysine, with the CAS number 126828-32-8, is a synthetic peptide composed of three amino acids: alanine, histidine, and lysine. This compound exhibits characteristics typical of peptides, including the ability to form hydrogen bonds, which can influence its solubility and stability in various environments. The presence of histidine imparts unique properties, such as buffering capacity and potential involvement in metal ion coordination, while lysine contributes positive charge and potential for interaction with negatively charged molecules. L-Alanyl-L-histidyl-L-lysine may exhibit bioactive properties, making it of interest in fields such as biochemistry and pharmaceuticals. Its structure allows for potential applications in drug delivery systems, as well as in the development of functional foods or nutraceuticals. Additionally, the peptide's stability and reactivity can be influenced by factors such as pH and temperature, which are critical for its practical applications. Overall, this compound represents a versatile building block in peptide chemistry with potential therapeutic implications.
Formula:C15H26N6O4
InChI:InChI=1S/C15H26N6O4/c1-9(17)13(22)21-12(6-10-7-18-8-19-10)14(23)20-11(15(24)25)4-2-3-5-16/h7-9,11-12H,2-6,16-17H2,1H3,(H,18,19)(H,20,23)(H,21,22)(H,24,25)/t9-,11-,12-/m0/s1
InChI key:InChIKey=SHKGHIFSEAGTNL-DLOVCJGASA-N
SMILES:[C@H](C(N[C@@H](CCCCN)C(O)=O)=O)(NC([C@H](C)N)=O)CC1=CN=CN1
Synonyms:- 146: PN: WO2020086446 SEQID: 146 claimed protein
- L-Lysine, N2-(N-L-alanyl-L-histidyl)-
- L-Lysine, L-alanyl-L-histidyl-
- L-Alanyl-L-histidyl-L-lysine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
H-Ala-His-Lys-OH
CAS:The tripeptide AHK (tripeptide-3), a GHK analog, also forms complexes with Cu(II). AHK-Cu promoted the growth of human hair follicles in vitro.Formula:C15H26N6O4Purity:> 99%Color and Shape:White PowderMolecular weight:354.41AHK
CAS:AHK, a bioactive peptide known for its antioxidant properties, has been employed as a cosmetic ingredient [1].Formula:C15H26N6O4Purity:98%Color and Shape:SolidMolecular weight:354.4H-Ala-His-Lys-OH acetate salt
CAS:H-Ala-His-Lys-OH acetate salt is a copper complex that has been shown to have antioxidant properties in vitro. It has been studied for use as an analog of the vitamin C, which is a cofactor for collagen synthesis and follicular keratinization. Copper complexes with H-Ala-His-Lys-OH acetate salt have been shown to inhibit the formation of reactive oxygen species (ROS) and to stimulate collagen production by human dermal fibroblasts in vitro. This compound also stimulates the growth of human skin cells in vitro, which may be due to its ability to induce fibroblast proliferation.Formula:C15H26N6O4Purity:Min. 95%Molecular weight:354.4 g/mol




