CymitQuimica logo

CAS 126921-16-2

:

7-FLUORO-1H-INDOLE-3-CARBALDEHYDE

Description:
7-Fluoro-1H-indole-3-carbaldehyde is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a fluorine atom at the 7-position of the indole ring enhances its electronic properties and can influence its reactivity and biological activity. The aldehyde functional group at the 3-position makes it a versatile intermediate in organic synthesis, allowing for further derivatization. This compound is often utilized in medicinal chemistry and research due to its potential applications in drug development, particularly in the synthesis of various bioactive molecules. Its unique structure may also contribute to specific interactions with biological targets, making it of interest in pharmacological studies. As with many fluorinated compounds, it may exhibit distinct physical and chemical properties, such as altered solubility and stability, which can be advantageous in various applications. Safety and handling precautions should be observed due to its potential reactivity and biological effects.
Formula:C9H6FNO
InChI:InChI=1/C9H6FNO/c10-8-3-1-2-7-6(5-12)4-11-9(7)8/h1-5,11H
InChI key:AHVRLLVALCYEEP-UHFFFAOYSA-N
SMILES:c1cc2c(c[nH]c2c(c1)F)C=O
Synonyms:
  • 1H-indole-3-carboxaldehyde, 7-fluoro-
  • 7-Fluoro-1H-indole-3-carbaldehyde
  • 7-fluoro-1H-indol-3-carbaldehyde
Found 4 products.