CymitQuimica logo

CAS 127199-14-8

:

(1S,2S)-2-Fluorocyclopropanecarboxylic acid

Description:
(1S,2S)-2-Fluorocyclopropanecarboxylic acid is a fluorinated cyclopropane derivative characterized by its unique three-membered ring structure, which imparts distinctive chemical properties. The presence of a fluorine atom at the second carbon position enhances its reactivity and polarity, making it a valuable intermediate in organic synthesis. This compound features a carboxylic acid functional group, contributing to its acidity and potential for forming hydrogen bonds, which can influence its solubility in various solvents. The stereochemistry indicated by the (1S,2S) configuration suggests specific spatial arrangements of atoms, which can affect its biological activity and interactions with other molecules. Typically, such compounds are of interest in medicinal chemistry and agrochemicals due to their potential applications in drug development and as building blocks in synthetic pathways. Additionally, the compound's stability and reactivity can be influenced by factors such as temperature and pH, making it essential to consider these conditions during handling and experimentation.
Formula:C4H5FO2
InChI:InChI=1S/C4H5FO2/c5-3-1-2(3)4(6)7/h2-3H,1H2,(H,6,7)/t2-,3+/m1/s1
InChI key:InChIKey=HZQKMZGKYVDMCT-GBXIJSLDSA-N
SMILES:C(O)(=O)[C@H]1[C@@H](F)C1
Synonyms:
  • Cyclopropanecarboxylic acid, 2-fluoro-, (1S,2S)-
  • (+)-cis-2-Fluorocyclopropanecarboxylic acid
  • (1S,2S)-2-Fluorocyclopropanecarboxylic acid
  • Cyclopropanecarboxylic acid, 2-fluoro-, (1S-cis)-
  • (1S,2S)-2-Fluorocyclopropane-1-carboxylic acid
  • (cis)-2-fluorocyclopropanecarboxylic acid Relative stereochemistry
  • (1S,2S)-2-FLUOROCYCLOPROPANECARBOXYLIC ACID(WX900028)
Found 6 products.