CAS 1272322-42-5

4H-1-Benzopyran-3-carboxylic acid, 7-chloro-2-(2,5-difluorophenyl)-4-oxo-

Description:

4H-1-Benzopyran-3-carboxylic acid, 7-chloro-2-(2,5-difluorophenyl)-4-oxo- is a synthetic organic compound characterized by its complex structure, which includes a benzopyran core, a carboxylic acid functional group, and a chloro substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the carboxylic acid and carbonyl groups. The difluorophenyl group introduces additional electronic effects, which can influence the compound's reactivity and solubility. It may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. The presence of halogens, such as chlorine and fluorine, often enhances lipophilicity and can affect the compound's interaction with biological targets. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry and materials science, although specific properties such as melting point, solubility, and spectral characteristics would require empirical determination.

Formula: C₁₆H₇ClF₂O₄

InChI: InChI=1S/C16H7ClF2O4/c17-7-1-3-9-12(5-7)23-15(13(14(9)20)16(21)22)10-6-8(18)2-4-11(10)19/h1-6H,(H,21,22)

InChI key: NWCUBMQZYIIGFT-UHFFFAOYSA-N

SMILES: C1=CC(=C(C=C1F)C2=C(C(=O)C3=C(O2)C=C(C=C3)Cl)C(=O)O)F

Synonyms:

• 4H-1-Benzopyran-3-carboxylic acid, 7-chloro-2-(2,5-difluorophenyl)-4-oxo-

TNF-α-IN-18

CAS: 1272322-42-5

TNF-α-IN-18

Formula: C₁₆H₇ClF₂O₄

Purity: 99.5%

Molecular weight: 336.67

Ref: 54-BUP22252

TNF-α-IN-18

CAS: 1272322-42-5

TNF-α-IN-18 is a small molecule TNF-α inhibitor that blocks NF-κB translocation, alleviates sepsis in models, and protects against rheumatoid arthritis in mice.

Formula: C₁₆H₇ClF₂O₄

Purity: 99.77%

Color and Shape: Solid

Molecular weight: 336.67

Ref: TM-T88696