CymitQuimica logo

CAS 1272758-40-3

:

1,1-Dimethylethyl tetrahydro-6-hydroxy-1,4-oxazepine-4(5H)-carboxylate

Description:
1,1-Dimethylethyl tetrahydro-6-hydroxy-1,4-oxazepine-4(5H)-carboxylate, identified by its CAS number 1272758-40-3, is a chemical compound that features a unique oxazepine ring structure, which is a seven-membered heterocyclic compound containing both nitrogen and oxygen atoms. This compound is characterized by the presence of a tetrahydro structure, indicating it is saturated and has undergone hydrogenation. The hydroxyl group at the 6-position contributes to its potential reactivity and solubility in polar solvents. The dimethyl substituent at the 1-position enhances steric hindrance, which may influence its biological activity and interactions with other molecules. Additionally, the carboxylate group suggests potential for forming salts or esters, which can affect its pharmacokinetic properties. Overall, this compound may exhibit interesting chemical behavior and biological activity, making it a subject of interest in medicinal chemistry and related fields. However, specific applications and properties would require further investigation through experimental studies.
Formula:C10H19NO4
InChI:InChI=1S/C10H19NO4/c1-10(2,3)15-9(13)11-4-5-14-7-8(12)6-11/h8,12H,4-7H2,1-3H3
InChI key:InChIKey=HFIKYUQRVQDAKC-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CC(O)COCC1
Synonyms:
  • 1,4-Oxazepine-4(5H)-carboxylic acid, tetrahydro-6-hydroxy-, 1,1-dimethylethyl ester
  • 1,1-Dimethylethyl tetrahydro-6-hydroxy-1,4-oxazepine-4(5H)-carboxylate
  • tert-Butyl 6-hydroxy-1,4-oxazepan-4-carboxylate
Found 5 products.