CAS 127346-48-9
:N-Boc-1,3-diaminopropane hydrochloride
Description:
N-Boc-1,3-diaminopropane hydrochloride is a chemical compound characterized by its structure, which includes a Boc (tert-butyloxycarbonyl) protecting group attached to a 1,3-diaminopropane backbone. This compound is typically used in organic synthesis, particularly in the preparation of various pharmaceuticals and biologically active molecules, due to its ability to protect amine functionalities during chemical reactions. The hydrochloride salt form enhances its solubility in water, making it more accessible for various applications. N-Boc-1,3-diaminopropane hydrochloride is generally stable under standard laboratory conditions but should be stored in a cool, dry place to prevent degradation. Its molecular structure allows for the potential formation of various derivatives, which can be tailored for specific chemical reactions. Safety precautions should be observed when handling this compound, as with all chemicals, to avoid any adverse reactions or exposure. Overall, its versatility and protective capabilities make it a valuable intermediate in synthetic organic chemistry.
Formula:C8H19ClN2O2
InChI:InChI=1/C8H18N2O2.ClH/c1-8(2,3)12-7(11)10-6-4-5-9;/h4-6,9H2,1-3H3,(H,10,11);1H
SMILES:CC(C)(C)OC(=NCCCN)O.Cl
Synonyms:- N-Boc-1,3-propanediamine hydrochloride~N-tert-Butoxycarbonyl-1,3-diaminopropane hydrochloride~tert-Butyl N-(3-aminopropyl)carbamate hydrochloride
- Tert-Butyl (3-Aminopropyl)Carbamate Hydrochloride (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
N-Boc-1,3-diaminopropane hydrochloride, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C8H19ClN2O2Purity:98%Color and Shape:White, Crystals or powder or crystalline powderMolecular weight:210.70N-Boc-1,3-diaminopropane, HCl
CAS:Formula:C8H19ClN2O2Purity:97%Color and Shape:SolidMolecular weight:210.7017tert-Butyl (3-aminopropyl)carbamate hydrochloride
CAS:tert-Butyl (3-aminopropyl)carbamate hydrochloridePurity:98%Molecular weight:210.71g/molN-(3-Aminopropyl)carbamic acid tert-butyl ester hydrochloride
CAS:Formula:C8H19ClN2O2Purity:97%Color and Shape:SolidMolecular weight:210.7



