CymitQuimica logo

CAS 127346-48-9

:

N-Boc-1,3-diaminopropane hydrochloride

Description:
N-Boc-1,3-diaminopropane hydrochloride is a chemical compound characterized by its structure, which includes a Boc (tert-butyloxycarbonyl) protecting group attached to a 1,3-diaminopropane backbone. This compound is typically used in organic synthesis, particularly in the preparation of various pharmaceuticals and biologically active molecules, due to its ability to protect amine functionalities during chemical reactions. The hydrochloride salt form enhances its solubility in water, making it more accessible for various applications. N-Boc-1,3-diaminopropane hydrochloride is generally stable under standard laboratory conditions but should be stored in a cool, dry place to prevent degradation. Its molecular structure allows for the potential formation of various derivatives, which can be tailored for specific chemical reactions. Safety precautions should be observed when handling this compound, as with all chemicals, to avoid any adverse reactions or exposure. Overall, its versatility and protective capabilities make it a valuable intermediate in synthetic organic chemistry.
Formula:C8H19ClN2O2
InChI:InChI=1/C8H18N2O2.ClH/c1-8(2,3)12-7(11)10-6-4-5-9;/h4-6,9H2,1-3H3,(H,10,11);1H
InChI key:WUXOJNUZYOFBMI-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=NCCCN)O.Cl
Synonyms:
  • N-Boc-1,3-propanediamine hydrochloride~N-tert-Butoxycarbonyl-1,3-diaminopropane hydrochloride~tert-Butyl N-(3-aminopropyl)carbamate hydrochloride
  • Tert-Butyl (3-Aminopropyl)Carbamate Hydrochloride (1:1)
Found 6 products.