CymitQuimica logo

CAS 1276056-84-8

:

3-Bromo-6-methylimidazo[1,2-a]pyrazine

Description:
3-Bromo-6-methylimidazo[1,2-a]pyrazine is a heterocyclic organic compound characterized by its fused imidazole and pyrazine rings, which contribute to its unique chemical properties. The presence of a bromine atom at the 3-position and a methyl group at the 6-position of the imidazo ring influences its reactivity and solubility. This compound is typically a solid at room temperature and exhibits moderate stability under standard conditions. It is of interest in various fields, including medicinal chemistry and material science, due to its potential biological activities and applications. The bromine substituent can enhance the compound's reactivity in nucleophilic substitution reactions, while the methyl group may affect its steric and electronic properties. Additionally, compounds of this class are often studied for their roles in biological systems, particularly in relation to mutagenicity and carcinogenicity. As with many heterocycles, the specific interactions and behaviors of 3-Bromo-6-methylimidazo[1,2-a]pyrazine can vary significantly based on the surrounding environment and conditions.
Formula:C7H6BrN3
InChI:InChI=1S/C7H6BrN3/c1-5-4-11-6(8)2-10-7(11)3-9-5/h2-4H,1H3
InChI key:InChIKey=ZSUZBYIIQKISEK-UHFFFAOYSA-N
SMILES:BrC=1N2C(C=NC(C)=C2)=NC1
Synonyms:
  • 3-Bromo-6-methylimidazo[1,2-a]pyrazine
  • Imidazo[1,2-a]pyrazine, 3-bromo-6-methyl-
Found 4 products.