CymitQuimica logo

CAS 127626-06-6

:

5-FLUORO-3-(1,2,3,6-TETRAHYDRO-PYRIDIN-4-YL)-1H-INDOLE

Description:
5-Fluoro-3-(1,2,3,6-tetrahydro-pyridin-4-yl)-1H-indole is a chemical compound characterized by its complex structure, which includes an indole core substituted with a fluorine atom and a tetrahydropyridine moiety. The presence of the fluorine atom typically enhances the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The tetrahydropyridine ring contributes to the compound's potential pharmacological properties, as it can participate in various interactions with biological targets. This compound is often studied for its potential applications in drug development, particularly in the context of neuropharmacology and oncology. Its molecular structure suggests that it may exhibit unique reactivity and binding characteristics, which are essential for understanding its mechanism of action. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it a subject of interest for further research in synthetic and medicinal chemistry.
Formula:C13H13FN2
InChI:InChI=1S/C13H13FN2/c14-10-1-2-13-11(7-10)12(8-16-13)9-3-5-15-6-4-9/h1-3,7-8,15-16H,4-6H2
InChI key:NOBJPJHWOFGLFA-UHFFFAOYSA-N
SMILES:C1CNCC=C1C2=CNC3=C2C=C(C=C3)F
Found 2 products.