CAS 127791-54-2
:(2E)-3-(3,5-Dihydroxyphenyl)-2-propenoic acid
Description:
(2E)-3-(3,5-Dihydroxyphenyl)-2-propenoic acid, commonly known as a derivative of phenolic compounds, exhibits several notable characteristics. This compound features a propenoic acid backbone, which contributes to its reactivity and potential applications in organic synthesis. The presence of the 3,5-dihydroxyphenyl group enhances its antioxidant properties, making it of interest in various biological and pharmaceutical contexts. Its structure suggests it may participate in hydrogen bonding due to the hydroxyl groups, influencing its solubility and interaction with biological molecules. The compound is likely to be soluble in polar solvents, reflecting the hydrophilic nature imparted by the hydroxyl groups. Additionally, its potential as a bioactive agent may be explored in the fields of medicine and nutrition, particularly for its possible roles in modulating oxidative stress and inflammation. Overall, (2E)-3-(3,5-Dihydroxyphenyl)-2-propenoic acid represents a compound with significant chemical and biological relevance, warranting further investigation into its properties and applications.
Formula:C9H8O4
InChI:InChI=1S/C9H8O4/c10-7-3-6(1-2-9(12)13)4-8(11)5-7/h1-5,10-11H,(H,12,13)/b2-1+
InChI key:InChIKey=MFFCZSWTQMCKFP-OWOJBTEDSA-N
SMILES:C(=C/C(O)=O)\C1=CC(O)=CC(O)=C1
Synonyms:- (2E)-3-(3,5-Dihydroxyphenyl)-2-propenoic acid
- 2-Propenoic acid, 3-(3,5-dihydroxyphenyl)-, (2E)-
- 2-Propenoic acid, 3-(3,5-dihydroxyphenyl)-, (E)-
- (E)-3-(3,5-Dihydroxyphenyl)acrylic acid
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
(E)-3-(3,5-Dihydroxyphenyl)acrylic acid
CAS:(E)-3-(3,5-Dihydroxyphenyl)acrylic acidFormula:C9H8O4Purity:97%Molecular weight:180.16(E)-3-(3,5-Dihydroxyphenyl)acrylic acid
CAS:Formula:C9H8O4Purity:97%Color and Shape:SolidMolecular weight:180.1574(E)-3-(3,5-Dihydroxyphenyl)acrylic acid
CAS:(E)-3-(3,5-Dihydroxyphenyl)acrylic acid (DHPA) is a naturally occurring molecule that is found in human urine. It has been shown to inhibit protein synthesis and cell proliferation in the urinary tract. DHPA has also been shown to have anti-inflammatory effects by inhibiting neutrophil activation. The mechanism of this effect is not fully understood, but it may be due to the presence of methoxy groups on the molecule. There are two isomers of DHPA: trans and cis. Trans-DHPA has been shown to have more potent anti-inflammatory effects than cis-DHPA.Formula:C9H8O4Purity:Min. 95%Color and Shape:PowderMolecular weight:180.16 g/mol(E)-3-(3,5-Dihydroxyphenyl)acrylic acid
CAS:Purity:97%Color and Shape:SolidMolecular weight:180.1589966(E)-3-(3,5-Dihydroxyphenyl)acrylic acid
CAS:(E)-3-(3,5-Dihydroxyphenyl)acrylic acidFormula:C9H8O4Purity:98%Molecular weight:180.16
