CAS 1279032-31-3
:(1R,3S)-3-Aminocyclopentanol hydrochloride
Description:
(1R,3S)-3-Aminocyclopentanol hydrochloride is a chiral cyclic amine characterized by its cyclopentane structure with an amino group and a hydroxyl group. The presence of the amino group imparts basic properties, while the hydroxyl group contributes to its potential as a hydrogen bond donor. The hydrochloride form indicates that it is a salt, which enhances its solubility in water and makes it suitable for various applications, particularly in pharmaceutical formulations. The specific stereochemistry (1R,3S) suggests that it has distinct spatial arrangements, which can influence its biological activity and interactions with receptors or enzymes. This compound may be of interest in medicinal chemistry for its potential role in drug development, particularly in the synthesis of compounds that target neurological or psychiatric conditions. Its properties, such as melting point, solubility, and reactivity, would be influenced by its molecular structure and the presence of functional groups, making it a subject of study in both organic and medicinal chemistry.
Formula:C5H12ClNO
InChI:InChI=1S/C5H11NO.ClH/c6-4-1-2-5(7)3-4;/h4-5,7H,1-3,6H2;1H/t4-,5+;/m0./s1
InChI key:SGKRJNWIEGYWGE-UYXJWNHNSA-N
SMILES:C1C[C@H](C[C@H]1N)O.Cl
Synonyms:- (1R,3S)-3-Aminocyclopentanolhydrochloride
- (1R,3S)-3-aminocyclopentan-1-ol hydrochloride
- 1R,3S)-3-Aminocyclopentanol
- (1R,3S)-3-AMinocyclopentanol hydrochloride ISO 9001:2015 REACH
- Intermediate of Bictegravir
- hydrochloride(Bictegravir)
- Cyclopentanol, 3-amino-, hydrochloride (1:1), (1R,3S)-
- (1R,3S)-3-aminocyclopentanolHCL
- 1R.3S)-3-
- de
- Aminocyclopentaro1hydroch1oj
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
(1R,3S)-3-Aminocyclopentanol hydrochloride
CAS:Formula:C5H12ClNOPurity:98%Color and Shape:SolidMolecular weight:137.6079Ref: IN-DA000XIX
100mg24.00€250mg28.00€1g34.00€5g65.00€10g99.00€25g141.00€50g235.00€100g352.00€250g600.00€500g748.00€1kg1,308.00€5kg6,291.00€(1R,3S)-3-Aminocyclopentanol Hydrochloride
CAS:(1R,3S)-3-Aminocyclopentanol HydrochlorideFormula:C5H12ClNOPurity:98%Molecular weight:137.61(1R,3S)-3-Aminocyclopentanol Hydrochloride
CAS:Controlled ProductApplications (1R,3S)-3-Aminocyclopentanol Hydrochloride is used to for the preparation of 6-Aminopyridin-3-ylthiazoles as a method of treating or ameliorating a syndrome, disorder or disease related rheumatoid arthritis or psoriasis.
References Goldberg, S., et al.: PCT Int. Appl., 793pp (2017)Formula:C5H11NO·ClHColor and Shape:NeatMolecular weight:137.61(1R,3S)-3-Aminocyclopentanol hydrochloride
CAS:(1R,3S)-3-Aminocyclopentanol hydrochlorideFormula:C5H12ClNOPurity:97%Molecular weight:137.61(1R,3S)-3-Aminocyclopentanol hydrochloride
CAS:Formula:C5H12ClNOPurity:97%Color and Shape:SolidMolecular weight:137.61(1R,3S)-3-Aminocyclopentanol hydrochloride
CAS:Intermediate in the synthesis of bictegravirFormula:C5H12ClNOPurity:Min. 95%Molecular weight:137.61 g/mol





