CAS 127913-44-4
:(S)-(-)-4-chloro 3-hydroxybutyronitrile
Description:
(S)-(-)-4-chloro-3-hydroxybutyronitrile, with the CAS number 127913-44-4, is a chiral organic compound characterized by its specific stereochemistry and functional groups. It features a hydroxyl group (-OH) and a nitrile group (-CN) attached to a butyronitrile backbone, along with a chlorine atom at the fourth carbon position. This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. Its chirality indicates that it exists in two enantiomeric forms, with the (S)-(-) configuration being the biologically active form. The presence of the hydroxyl group suggests potential for hydrogen bonding, influencing its solubility in polar solvents. Additionally, the nitrile group contributes to its reactivity, making it useful in various synthetic applications, particularly in pharmaceutical chemistry. The compound's specific properties, such as melting point, boiling point, and solubility, can vary based on purity and environmental conditions, but it is generally handled with care due to its potential biological activity and reactivity.
Formula:C4H6ClNO
InChI:InChI=1/C4H6ClNO/c5-3-4(7)1-2-6/h4,7H,1,3H2/t4-/m0/s1
SMILES:C(C#N)[C@@H](CCl)O
Synonyms:- S-(-)-4-chloro-3-hydorxy butyronitrile
- (3S)-4-chloro-3-hydorxybutyronitrile
- (3R)-4-chloro-3-hydroxybutanenitrile
- (3S)-4-chloro-3-hydroxybutanenitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
(S)-(-)-4-Chloro-3-hydroxybutyronitrile
CAS:Formula:C4H6ClNOPurity:>98.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:119.55Butanenitrile, 4-chloro-3-hydroxy-, (3S)-
CAS:Formula:C4H6ClNOPurity:97%Color and Shape:LiquidMolecular weight:119.5495(S)-4-Chloro-3-hydroxybutyronitrile
CAS:(S)-4-Chloro-3-hydroxybutyronitrilePurity:98%Molecular weight:119.55g/mol(3S)-4-Chloro-3-hydroxybutyronitrile
CAS:Controlled Product<p>Applications (3S)-4-Chloro-3-hydroxybutyronitrile is used in various organic precursor syntheses. It is used in the synthesis of hydroxypyrrolidinones to by used as carbapenem precursors. Also used in the preparation of atorvastatin (A791750) precursors. Impurity in the synthesis of Rosuvastatin (R700500), a selective, competitive HMG-CoA reductase inhibitor. Antilipemic.<br>References Kanno, O. et al.: Hetero., 53, 173 (2000); Watanabe, M., et al.: Bioorg. Med. Chem., 5, 437 (1997), Lee, E., et al.: Clin. Pharmacol. Ther., 78, 330 (2005), Ferdinand, K.C., et al.: Am. J. Cardiol., 97, 229 (2006); Jiang, C. et al.: Lett. Org. Chem., 9, 520 (2012);<br></p>Formula:C4H6ClNOColor and Shape:NeatMolecular weight:119.55(S)-4-Chloro-3-hydroxybutyronitrile
CAS:Formula:C4H6ClNOPurity:97%Color and Shape:LiquidMolecular weight:119.55





