CAS 128071-98-7
:4-bromo-2-fluoropyridine
Description:
4-Bromo-2-fluoropyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with both bromine and fluorine atoms. The bromine atom is located at the 4-position, while the fluorine atom is at the 2-position of the pyridine ring. This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its role in various chemical syntheses, particularly in the pharmaceutical and agrochemical industries, due to its reactivity and ability to participate in nucleophilic substitution reactions. The presence of both halogens enhances its electrophilic character, making it a valuable intermediate in the synthesis of more complex molecules. Additionally, 4-bromo-2-fluoropyridine exhibits moderate solubility in organic solvents, and its handling requires standard safety precautions due to the potential toxicity associated with halogenated compounds. Its molecular structure contributes to its unique chemical properties, making it a subject of interest in organic chemistry research.
Formula:C5H3BrFN
InChI:InChI=1/C5H3BrFN/c6-4-1-2-8-5(7)3-4/h1-3H
SMILES:c1cnc(cc1Br)F
Synonyms:- 2-Fluoro-4-Bromopyridine
- 1-(Difluoromethoxy)-4-Iodobenzene
- 4-Bromo-2-fluoro-pyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
4-Bromo-2-fluoropyridine
CAS:Formula:C5H3BrFNPurity:>98.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:175.994-Bromo-2-fluoropyridine, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C5H3BrFNPurity:95%Color and Shape:Clear colorless to pale yellow, LiquidMolecular weight:175.99Pyridine, 4-bromo-2-fluoro-
CAS:Formula:C5H3BrFNPurity:98%Color and Shape:LiquidMolecular weight:175.98644-Bromo-2-fluoropyridine
CAS:4-Bromo-2-fluoropyridineFormula:C5H3BrFNPurity:98%Color and Shape:LiquidMolecular weight:175.986424-Bromo-2-fluoropyridine
CAS:4-Bromo-2-fluoropyridine is a heterocyclic amine that belongs to the class of cannabinoid type. It has been shown to be stereoselective, and can be used as a sulfamidate in biomolecular studies. 4-Bromo-2-fluoropyridine is activated by chloride and nucleophilic, which are properties that make it useful for functional groups. The fluorine atom on this molecule also makes it reactive, making it possible to use the substance as an enantiopure catalyst for organic reactions.
Formula:C5H3BrFNPurity:Min. 98 Area-%Color and Shape:Colorless Clear LiquidMolecular weight:175.99 g/mol4-Bromo-2-fluoropyridine
CAS:Formula:C5H3BrFNPurity:96%Color and Shape:Liquid, ClearMolecular weight:175.988







