CymitQuimica logo

CAS 1282516-77-1

:

2-(4-Bromo-2-fluorophenyl)-4-[3-methyl-1-(1-methylethyl)-1H-1,2,4-triazol-5-yl]-1H-imidazole-1-ethanol

Description:
The chemical substance known as 2-(4-Bromo-2-fluorophenyl)-4-[3-methyl-1-(1-methylethyl)-1H-1,2,4-triazol-5-yl]-1H-imidazole-1-ethanol, with the CAS number 1282516-77-1, is a complex organic compound characterized by its multi-ring structure and the presence of various functional groups. It features an imidazole ring, which is a five-membered heterocyclic compound containing nitrogen atoms, and a triazole moiety, which contributes to its potential biological activity. The presence of bromine and fluorine substituents on the phenyl ring can influence the compound's reactivity and lipophilicity, potentially enhancing its pharmacological properties. The compound is likely to exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. Its ethanol group suggests potential solubility in polar solvents, which may facilitate its use in various formulations. Overall, this compound's unique structural features may contribute to its efficacy in therapeutic applications, although detailed studies would be necessary to elucidate its specific biological activities and mechanisms of action.
Formula:C17H19BrFN5O
InChI:InChI=1S/C17H19BrFN5O/c1-10(2)24-17(20-11(3)22-24)15-9-23(6-7-25)16(21-15)13-5-4-12(18)8-14(13)19/h4-5,8-10,25H,6-7H2,1-3H3
InChI key:InChIKey=MXQLKKJIZSLULM-UHFFFAOYSA-N
SMILES:C(CO)N1C(=NC(=C1)C=2N(C(C)C)N=C(C)N2)C3=C(F)C=C(Br)C=C3
Synonyms:
  • 1H-Imidazole-1-ethanol, 2-(4-bromo-2-fluorophenyl)-4-[3-methyl-1-(1-methylethyl)-1H-1,2,4-triazol-5-yl]-
  • 2-(4-Bromo-2-fluorophenyl)-4-[3-methyl-1-(1-methylethyl)-1H-1,2,4-triazol-5-yl]-1H-imidazole-1-ethanol
  • 2-[2-(4-Bromo-2-fluorophenyl)-4-(5-methyl-2-propan-2-yl-1,2,4-triazol-3-yl)imidazol-1-yl]ethanol
Found 2 products.