CAS 128322-44-1
:MCLA
Description:
MCLA, or 4-Methyl-2-(4-chlorophenyl)-1,3-thiazole, is a chemical compound characterized by its thiazole ring structure, which contributes to its unique chemical properties. It typically appears as a solid and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the methyl and chlorophenyl groups enhances its reactivity and solubility in organic solvents. MCLA may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its molecular structure allows for interactions with biological targets, which can lead to various pharmacological effects. As with many chemical substances, safety and handling precautions are essential, as MCLA may pose risks if not managed properly. It is crucial to refer to safety data sheets and regulatory guidelines when working with this compound to ensure safe usage and compliance with environmental regulations.
Formula:C14H14ClN3O2
InChI:InChI=1/C14H13N3O2.ClH/c1-9-14(18)17-8-12(15-7-13(17)16-9)10-3-5-11(19-2)6-4-10;/h3-8,15H,1-2H3;1H
SMILES:Cc1c(=O)n2cc(c3ccc(cc3)OC)[nH]cc2n1.Cl
Synonyms:- Mcla, Hydrochloride
- Cypridina Luciferin Methoxy-Analogue
- 2-Methyl-6-(4-Methoxyphenyl)-3,7-Dihydroimidazo[1,2-A]Pyrazin-3(7H)-One Hydrochloride
- 2-Methyl-6-(4-Methoxyphenyl)-3,7-Dihydroimidazo[1,2-A]Pyrazin-3-One Hydrochloride
- 6-(4-Methoxyphenyl)-2-Methyl-3,7-Dihydroimidazo[1,2-A]Pyrazin-3(7H)-One Hydrochloride
- 6-(4-Methoxyphenyl)-2-Methyl-3,7-Dihydroimidazo[1,2-A]Pyrazin-3-One Hydrochloride
- 6-(4-Meophe.)-2-Me-3,7-Dihydroimidazo(A)Pyrazin-3(7H)-On-Hcl
- 6-(4-methoxyphenyl)-2-methylimidazo[1,2-a]pyrazin-3(7H)-one hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
MCLA [Chemiluminescence Reagent]
CAS:Formula:C14H13N3O2·HClPurity:>98.0%(HPLC)Color and Shape:White to Brown powder to crystalMolecular weight:291.74MCLA [Chemiluminescence Reagent]
CAS:MCLA [Chemiluminescence Reagent]Formula:C14H13N3O2·HClPurity:>98.0%Molecular weight:291.74MCLA (hydrochloride)
CAS:Formula:C14H14ClN3O2Purity:95%Color and Shape:SolidMolecular weight:291.7329MCLA Hydrochloride
CAS:Controlled ProductFormula:C14H13N3O2·HClColor and Shape:NeatMolecular weight:291.733MCLA hydrochloride
CAS:MCLA hydrochloride, a chemiluminescent compound, can be used to quantify aqueous concentrations of superoxide.Formula:C14H14ClN3O2Purity:98%Color and Shape:SolidMolecular weight:291.732-Methyl-6-(4-methoxyphenyl)-3,7-dihydroimidazo(1,2-a)pyrazin-3-one hydrochloride
CAS:2-Methyl-6-(4-methoxyphenyl)-3,7-dihydroimidazo(1,2-a)pyrazin-3-one hydrochloride (ABI) is a potent and selective inhibitor of the enzyme toll-like receptor. The drug has been shown to decrease the metabolic rate in experimental models. ABI has also been used as an analog for other compounds to study their effects on redox potentials and reactive species. It is unclear how ABI inhibits protein synthesis by polymerase chain reaction (PCR). One possible mechanism is that it may inhibit the binding of primers to DNA. ABI also inhibits the production of chemokines which are small proteins that stimulate inflammatory responses. This drug can be used in autoimmune diseases such as rheumatoid arthritis and multiple sclerosis.Purity:Min. 95%Molecular weight:290.72 g/mol





