CymitQuimica logo

CAS 1286207-38-2

:

1,1-Dimethylethyl N-[(3S)-1-[(3-bromophenyl)methyl]-3-pyrrolidinyl]carbamate

Description:
1,1-Dimethylethyl N-[(3S)-1-[(3-bromophenyl)methyl]-3-pyrrolidinyl]carbamate, identified by its CAS number 1286207-38-2, is a chemical compound characterized by its complex structure, which includes a carbamate functional group and a pyrrolidine ring. This compound features a branched alkyl group (1,1-dimethylethyl) that contributes to its steric properties, potentially influencing its reactivity and interaction with biological targets. The presence of a bromophenyl moiety suggests that it may exhibit unique electronic properties, which can affect its pharmacological activity. The stereochemistry indicated by the (3S) configuration is crucial for its biological function, as it may determine how the molecule interacts with specific receptors or enzymes. Overall, this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity and the presence of functional groups that can participate in various chemical reactions. Further studies would be necessary to elucidate its specific properties and applications.
Formula:C16H23BrN2O2
InChI:InChI=1S/C16H23BrN2O2/c1-16(2,3)21-15(20)18-14-7-8-19(11-14)10-12-5-4-6-13(17)9-12/h4-6,9,14H,7-8,10-11H2,1-3H3,(H,18,20)/t14-/m0/s1
InChI key:InChIKey=DTEUBCRJSWJARX-AWEZNQCLSA-N
SMILES:C(N1C[C@@H](NC(OC(C)(C)C)=O)CC1)C2=CC(Br)=CC=C2
Synonyms:
  • Carbamic acid, N-[(3S)-1-[(3-bromophenyl)methyl]-3-pyrrolidinyl]-, 1,1-dimethylethyl ester
  • 1,1-Dimethylethyl N-[(3S)-1-[(3-bromophenyl)methyl]-3-pyrrolidinyl]carbamate
  • (S)-tert-Butyl 1-(3-bromobenzyl)pyrrolidin-3-ylcarbamate
Found 1 products.