CymitQuimica logo

CAS 1286273-06-0

:

4-Piperidinemethanamine, 1-cyclobutyl-, hydrochloride (1:2)

Description:
4-Piperidinemethanamine, 1-cyclobutyl-, hydrochloride (1:2) is a chemical compound characterized by its piperidine and cyclobutyl functional groups. It typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. This compound is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it may exhibit biological activity related to neurotransmitter modulation. The presence of the piperidine ring contributes to its basicity, allowing it to form salts with acids, while the cyclobutyl group may influence its steric and electronic properties. As with many amines, it may participate in various chemical reactions, including alkylation and acylation. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C10H20N2·2ClH
InChI:InChI=1S/C10H20N2.2ClH/c11-8-9-4-6-12(7-5-9)10-2-1-3-10;;/h9-10H,1-8,11H2;2*1H
InChI key:InChIKey=FSAGXDDSLFVQGP-UHFFFAOYSA-N
SMILES:C(N)C1CCN(CC1)C2CCC2.Cl
Synonyms:
  • 4-Piperidinemethanamine, 1-cyclobutyl-, hydrochloride (1:2)
Found 2 products.