CymitQuimica logo

CAS 1286273-97-9

:

1,1-Dimethylethyl N-[1-(3,3-dimethyl-2-oxobutyl)-4-piperidinyl]carbamate

Description:
1,1-Dimethylethyl N-[1-(3,3-dimethyl-2-oxobutyl)-4-piperidinyl]carbamate, identified by its CAS number 1286273-97-9, is a chemical compound that belongs to the class of carbamates. This substance features a complex molecular structure characterized by a piperidine ring, which contributes to its potential biological activity. The presence of the dimethyl groups and the oxobutyl moiety suggests that it may exhibit lipophilic properties, potentially influencing its solubility and permeability in biological systems. Carbamates are known for their applications in various fields, including agriculture as pesticides and in pharmaceuticals. The specific arrangement of functional groups in this compound may impart unique pharmacological properties, making it of interest for research in medicinal chemistry. Additionally, the stability and reactivity of the compound can be influenced by environmental factors, which is crucial for its application and safety assessment. Overall, this compound represents a significant area of study for its potential uses and effects in various chemical and biological contexts.
Formula:C16H30N2O3
InChI:InChI=1S/C16H30N2O3/c1-15(2,3)13(19)11-18-9-7-12(8-10-18)17-14(20)21-16(4,5)6/h12H,7-11H2,1-6H3,(H,17,20)
InChI key:InChIKey=PZDQOVJTMMZYBH-UHFFFAOYSA-N
SMILES:C(C(C(C)(C)C)=O)N1CCC(NC(OC(C)(C)C)=O)CC1
Synonyms:
  • Carbamic acid, N-[1-(3,3-dimethyl-2-oxobutyl)-4-piperidinyl]-, 1,1-dimethylethyl ester
  • 1,1-Dimethylethyl N-[1-(3,3-dimethyl-2-oxobutyl)-4-piperidinyl]carbamate
  • tert-Butyl 1-(3,3-dimethyl-2-oxobutyl)piperidin-4-ylcarbamate
Found 1 products.