CymitQuimica logo

CAS 1286274-21-2

:

1,1-Dimethylethyl N-[[1-(cyclobutylmethyl)-4-piperidinyl]methyl]carbamate

Description:
1,1-Dimethylethyl N-[[1-(cyclobutylmethyl)-4-piperidinyl]methyl]carbamate, identified by its CAS number 1286274-21-2, is a chemical compound that belongs to the class of carbamates. This substance features a complex molecular structure characterized by the presence of a dimethyl group, a piperidine ring, and a cyclobutylmethyl substituent. Its molecular architecture suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The compound may exhibit specific pharmacological properties, which could include effects on neurotransmitter systems, given the presence of the piperidine moiety. Additionally, the steric hindrance introduced by the dimethyl groups may influence its bioavailability and receptor binding affinity. As with many carbamates, it is essential to consider its stability, solubility, and potential toxicity in various environments. Overall, this compound represents a unique structure that may offer insights into the design of new therapeutic agents.
Formula:C16H30N2O2
InChI:InChI=1S/C16H30N2O2/c1-16(2,3)20-15(19)17-11-13-7-9-18(10-8-13)12-14-5-4-6-14/h13-14H,4-12H2,1-3H3,(H,17,19)
InChI key:InChIKey=LITYUKFSSBJUID-UHFFFAOYSA-N
SMILES:C(N1CCC(CNC(OC(C)(C)C)=O)CC1)C2CCC2
Synonyms:
  • Carbamic acid, N-[[1-(cyclobutylmethyl)-4-piperidinyl]methyl]-, 1,1-dimethylethyl ester
  • 1,1-Dimethylethyl N-[[1-(cyclobutylmethyl)-4-piperidinyl]methyl]carbamate
Found 1 products.