CymitQuimica logo

CAS 1287752-89-9

:

B-[6-[(2,2-Dimethyl-1-oxopropyl)amino]-3-pyridinyl]boronic acid

Description:
B-[6-[(2,2-Dimethyl-1-oxopropyl)amino]-3-pyridinyl]boronic acid, identified by its CAS number 1287752-89-9, is a boronic acid derivative characterized by its boron atom bonded to a pyridine ring and an aminoalkyl side chain. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, which is significant in various biochemical applications, including drug design and molecular recognition. The presence of the pyridine moiety contributes to its potential as a ligand in coordination chemistry and its role in biological systems. Additionally, the dimethyl-substituted propyl group enhances its lipophilicity, potentially influencing its bioavailability and interaction with biological targets. The compound's structure suggests it may participate in various chemical reactions, including Suzuki coupling, which is a common method for forming carbon-carbon bonds in organic synthesis. Overall, this compound's unique structural features position it as a valuable entity in medicinal chemistry and materials science.
Formula:C10H15BN2O3
InChI:InChI=1S/C10H15BN2O3/c1-10(2,3)9(14)13-8-5-4-7(6-12-8)11(15)16/h4-6,15-16H,1-3H3,(H,12,13,14)
InChI key:InChIKey=UMNSJQDICLTXBG-UHFFFAOYSA-N
SMILES:N(C(C(C)(C)C)=O)C1=CC=C(B(O)O)C=N1
Synonyms:
  • Boronic acid, B-[6-[(2,2-dimethyl-1-oxopropyl)amino]-3-pyridinyl]-
  • B-[6-[(2,2-Dimethyl-1-oxopropyl)amino]-3-pyridinyl]boronic acid
Found 3 products.