CAS 129012-04-0

6-bromopyridine-2,3-diamine

Description:

6-Bromopyridine-2,3-diamine is an organic compound characterized by its pyridine ring substituted with a bromine atom and two amino groups at the 2 and 3 positions. This compound typically appears as a solid and is soluble in polar solvents due to the presence of amino groups, which can engage in hydrogen bonding. The bromine substituent introduces a halogen, which can influence the compound's reactivity and potential applications in synthesis and medicinal chemistry. The amino groups contribute to its basicity and can participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. 6-Bromopyridine-2,3-diamine may serve as an important intermediate in the synthesis of pharmaceuticals, agrochemicals, or other functional materials. Its unique structure allows for potential interactions with biological targets, making it of interest in drug discovery and development. As with many chemical substances, handling should be done with care, following appropriate safety protocols due to potential toxicity or reactivity.

Formula: C₅H₆BrN₃

InChI: InChI=1/C5H6BrN3/c6-4-2-1-3(7)5(8)9-4/h1-2H,7H2,(H2,8,9)

SMILES: c1cc(Br)nc(c1N)N

Synonyms:

• 6-Bromo-2,3-pyridinediamine

2,3-Pyridinediamine, 6-bromo-

CAS: 129012-04-0

Formula: C₅H₆BrN₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 188.0252

Ref: IN-DA000YS1

6-Bromo-2,3-diaminopyridine

CAS: 129012-04-0

6-Bromo-2,3-diaminopyridine

Formula: C₅H₆BrN₃

Purity: 97%

Color and Shape: White to yellow Solid

Molecular weight: 188.02524

Ref: 54-OR345244

6-Bromopyridine-2,3-diamine

CAS: 129012-04-0

Formula: C₅H₆BrN₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 188.028

Ref: 10-F210038

6-Bromopyridine-2,3-diamine

CAS: 129012-04-0

6-Bromopyridine-2,3-diamine

Formula: C₅H₆BrN₃

Purity: 97%

Molecular weight: 188.03

Ref: IN-DG167473