CymitQuimica logo

CAS 129077-51-6

:

4'-(4-NITROPHENYL)-2,2':6',2'-TERPYRIDINE

Description:
4'-(4-Nitrophenyl)-2,2':6',2'-terpyridine is an organic compound characterized by its complex structure, which includes a terpyridine backbone substituted with a nitrophenyl group. This compound features a central pyridine ring connected to two additional pyridine units, creating a tridentate ligand capable of coordinating with metal ions. The presence of the nitro group (-NO2) on the phenyl ring enhances its electron-withdrawing properties, which can influence the compound's reactivity and stability. Typically, such compounds exhibit interesting photophysical properties, making them useful in applications like sensors, catalysts, and materials science. Additionally, the ability of the terpyridine moiety to form chelates with transition metals can lead to the formation of coordination complexes with unique electronic and magnetic properties. The compound is likely to be soluble in organic solvents and may exhibit distinct colorimetric changes upon coordination, which can be exploited in various analytical techniques. Safety and handling precautions should be observed due to the potential toxicity associated with nitro-substituted compounds.
Formula:C21H14N4O2
InChI:InChI=1/C21H14N4O2/c26-25(27)17-9-7-15(8-10-17)16-13-20(18-5-1-3-11-22-18)24-21(14-16)19-6-2-4-12-23-19/h1-14H
InChI key:SLAKPUZCHMXDSL-UHFFFAOYSA-N
SMILES:c1ccnc(c1)c1cc(cc(c2ccccn2)n1)c1ccc(cc1)N(=O)=O
Synonyms:
  • 129077-51-6
  • 4'-(4-Nitrophenyl)-2,2':6',2''-terpyridin
  • 4'-(4-Nitrophényl)-2,2':6',2''-terpyridine
Found 4 products.