CAS 129424-08-4
:2-{1-methoxy-1-[3-(naphthalen-2-ylmethoxy)phenyl]propyl}-1,3-thiazole
Description:
2-{1-Methoxy-1-[3-(naphthalen-2-ylmethoxy)phenyl]propyl}-1,3-thiazole is a synthetic organic compound characterized by its complex structure, which includes a thiazole ring, a methoxy group, and a naphthalene moiety. The thiazole ring contributes to its potential biological activity, often associated with compounds that exhibit antimicrobial, antifungal, or anticancer properties. The presence of the methoxy group enhances the lipophilicity of the molecule, potentially influencing its solubility and permeability in biological systems. The naphthalene derivative adds to the compound's aromatic character, which can affect its electronic properties and interactions with biological targets. This compound may be of interest in medicinal chemistry for its potential therapeutic applications, although specific biological activities and mechanisms would require further investigation. As with many synthetic compounds, understanding its stability, reactivity, and interaction with other substances is crucial for its application in research or pharmaceuticals.
Formula:C24H23NO2S
InChI:InChI=1S/C24H23NO2S/c1-3-24(26-2,23-25-13-14-28-23)21-9-6-10-22(16-21)27-17-18-11-12-19-7-4-5-8-20(19)15-18/h4-16H,3,17H2,1-2H3
InChI key:InChIKey=XYRDHZXSQUWVCD-UHFFFAOYSA-N
SMILES:CCC(c1cccc(c1)OCc1ccc2ccccc2c1)(c1nccs1)OC
Synonyms:- 1-(3-(Naphth-2-ylmethoxy)phenyl)-1-(thiazol-2-yl)propyl methyl ether
- 2-[1-Methoxy-1-[3-(2-naphthalenylmethoxy)phenyl]propyl]thiazole
- Ici 211965
- Thiazole, 2-(1-methoxy-1-(3-(2-naphthalenylmethoxy)phenyl)propyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
ICI 211965
CAS:<p>ICI 211965 is a lipid hydroperoxides inhibitor that is used to treat chronic lymphocytic leukemia and other leukemias. It inhibits the production of prolymphocytic cells and has been shown to have antihistaminic properties. ICI 211965 is administered orally as a liposome formulation, which prevents it from being broken down by enzymes in the stomach and small intestine. This drug also inhibits the biosynthesis of inflammatory mediators such as prostaglandin E2 and leukotriene B4 in neutrophils, which may be responsible for its anti-inflammatory effects.</p>Formula:C24H23NO2SPurity:Min. 95%Molecular weight:389.5 g/molICI 211965
CAS:<p>ICI 211965 is a selective and orally potent of 5-Lipoxygenase (5-LPO).</p>Formula:C24H23NO2SPurity:98%Color and Shape:SolidMolecular weight:389.51

