CAS 129575-89-9
:4-METHOXYPHENYL 3,6-DI-O-BENZYL-2-DEOXY-2-PHTHALIMIDO-BETA-D-GLUCOPYRANOSIDE
Description:
4-Methoxyphenyl 3,6-di-O-benzyl-2-deoxy-2-phthalimido-β-D-glucopyranoside, with the CAS number 129575-89-9, is a complex glycoside derivative characterized by its unique structural features. This compound contains a glucopyranoside backbone, which is a six-membered cyclic form of glucose, modified with a methoxyphenyl group and two benzyl groups at the 3 and 6 positions. The presence of the phthalimido group at the 2-position adds to its chemical complexity and potential reactivity. The methoxy group contributes to the compound's solubility and may influence its biological activity. This substance is typically studied for its potential applications in medicinal chemistry, particularly in the development of glycosylated compounds that may exhibit specific biological activities, such as antimicrobial or antitumor effects. Its synthesis and characterization involve various organic chemistry techniques, including protection and deprotection strategies, to achieve the desired functional groups while maintaining the integrity of the glucopyranoside structure. Overall, this compound exemplifies the intricate design often found in carbohydrate chemistry and its applications in drug development.
Formula:C35H33NO8
InChI:InChI=1/C35H33NO8/c1-40-25-16-18-26(19-17-25)43-35-30(36-33(38)27-14-8-9-15-28(27)34(36)39)32(42-21-24-12-6-3-7-13-24)31(37)29(44-35)22-41-20-23-10-4-2-5-11-23/h2-19,29-32,35,37H,20-22H2,1H3/t29-,30-,31-,32-,35-/m1/s1
SMILES:COc1ccc(cc1)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](COCc2ccccc2)O1)O)OCc1ccccc1)N1C(=O)c2ccccc2C1=O
Synonyms:- 4-Methoxyphenyl 3,6-di-O-benzyl-2-deoxy-2-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)-beta-D-glucopyranoside
- beta-D-glucopyranoside, 4-methoxyphenyl 2-deoxy-2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)-3,6-bis-O-(phenylmethyl)-
- 2-[(2S,3R,4R,5S,6R)-4-benzyloxy-6-(benzyloxymethyl)-5-hydroxy-2-(4-methoxyphenoxy)tetrahydropyran-3-yl]isoindoline-1,3-dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
β-D-Glucopyranoside, 4-methoxyphenyl 2-deoxy-2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)-3,6-bis-O-(phenylmethyl)-
CAS:Formula:C35H33NO8Purity:95.0%Molecular weight:595.63844-Methoxyphenyl 3,6-Di-O-benzyl-2-deoxy-2-phthalimido-β-D-glucopyranoside
CAS:Formula:C35H33NO8Purity:>95.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:595.654-Methoxyphenyl 3,6-Di-O-benzyl-2-deoxy-2-phthalimido-b-D-glucopyranoside
CAS:<p>4-Methoxyphenyl 3,6-Di-O-benzyl-2-deoxy-2-phthalimido-b-D-glucopyranoside is a glycopeptide with sucrase activity. It has been shown to prevent the growth of cancer cells in vitro and in vivo by inhibiting the production of insulin and other hormones. The anti-tumor effect was also observed in virus infected cells, where it inhibited the replication of papilloma virus. 4MPBG was found to inhibit the multiplication of human immunodeficiency virus (HIV) in vitro by binding to HIV RNA and blocking its synthesis.</p>Formula:C35H33NO8Purity:Min. 95%Molecular weight:595.64 g/mol


