CymitQuimica logo

CAS 129819-40-5

:

1H-Pyrazole-4-carboxylic acid, 1-(difluoromethyl)-, ethyl ester

Description:
1H-Pyrazole-4-carboxylic acid, 1-(difluoromethyl)-, ethyl ester is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two nitrogen atoms. This compound features a carboxylic acid functional group and an ethyl ester moiety, contributing to its reactivity and solubility properties. The presence of the difluoromethyl group enhances its biological activity and lipophilicity, making it of interest in medicinal chemistry and agrochemical applications. Typically, compounds like this exhibit moderate to high stability under standard conditions, but their reactivity can vary based on the presence of functional groups. The compound's molecular structure allows for potential interactions with biological targets, which may lead to various pharmacological effects. Additionally, its synthesis and characterization involve standard organic chemistry techniques, and it may be utilized in research related to drug development or as an intermediate in the synthesis of more complex molecules. Safety and handling precautions should be observed due to its chemical nature and potential biological activity.
Formula:C7H8F2N2O2
InChI:InChI=1S/C7H8F2N2O2/c1-2-13-6(12)5-3-10-11(4-5)7(8)9/h3-4,7H,2H2,1H3
InChI key:GDQVXTACQLHVPB-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=CN(N=C1)C(F)F
Found 3 products.