CymitQuimica logo

CAS 129872-81-7

:

2,4-Dichloro-5-methyl-5H-pyrrolo[3,2-d]pyrimidine

Description:
2,4-Dichloro-5-methyl-5H-pyrrolo[3,2-d]pyrimidine is a heterocyclic organic compound characterized by its fused pyrrole and pyrimidine rings, which contribute to its unique chemical properties. The presence of two chlorine atoms at the 2 and 4 positions and a methyl group at the 5 position enhances its reactivity and solubility in various organic solvents. This compound typically exhibits a solid state at room temperature and may have moderate stability under standard conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of halogen substituents that can influence biological activity. Additionally, the compound may exhibit specific interactions with biological targets, making it of interest for further research in drug design and synthesis. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, 2,4-Dichloro-5-methyl-5H-pyrrolo[3,2-d]pyrimidine represents a significant structure within the realm of organic chemistry and pharmacology.
Formula:C7H5Cl2N3
InChI:InChI=1/C7H5Cl2N3/c1-12-3-2-4-5(12)6(8)11-7(9)10-4/h2-3H,1H3
InChI key:LYUFQUBRAUGFLK-UHFFFAOYSA-N
SMILES:Cn1ccc2c1c(Cl)nc(Cl)n2
Synonyms:
  • 5H-pyrrolo[3,2-d]pyrimidine, 2,4-dichloro-5-methyl-
Found 4 products.