CymitQuimica logo

CAS 130048-57-6

:

Octadecanoic-9,9,10,10-d4 acid

Description:
Octadecanoic-9,9,10,10-d4 acid, also known as deuterated stearic acid, is a saturated fatty acid characterized by a long hydrocarbon chain consisting of 18 carbon atoms. The presence of deuterium isotopes at the 9th and 10th carbon positions distinguishes it from its non-deuterated counterpart, making it useful in various scientific applications, particularly in nuclear magnetic resonance (NMR) spectroscopy and tracer studies. This compound is typically a white, waxy solid at room temperature and is insoluble in water but soluble in organic solvents. Its molecular structure contributes to its properties, such as a high melting point and stability under standard conditions. Octadecanoic-9,9,10,10-d4 acid is often utilized in research to study lipid metabolism, membrane dynamics, and as a standard in analytical chemistry due to its well-defined isotopic labeling. Additionally, it may have applications in the development of pharmaceuticals and biochemicals, where precise tracking of molecular behavior is essential.
Formula:C18H32D4O2
InChI:InChI=1S/C18H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-17H2,1H3,(H,19,20)/i9D2,10D2
InChI key:QIQXTHQIDYTFRH-YQUBHJMPSA-N
SMILES:[2H]C([2H])(CCCCCCCC)C([2H])([2H])CCCCCCCC(=O)O
Found 4 products.