CymitQuimica logo

CAS 13008-17-8

:

4-methyl-2-chloro-pyrimidine-5-carboxylic acid

Description:
4-Methyl-2-chloro-pyrimidine-5-carboxylic acid is a heterocyclic organic compound characterized by a pyrimidine ring substituted with a methyl group and a chlorine atom, as well as a carboxylic acid functional group. The presence of the chlorine atom at the 2-position and the carboxylic acid at the 5-position contributes to its reactivity and potential applications in various chemical syntheses. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. Its structure allows for potential interactions in biological systems, making it of interest in pharmaceutical research. The compound may also serve as an intermediate in the synthesis of other organic compounds, particularly in the development of agrochemicals or pharmaceuticals. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 4-methyl-2-chloro-pyrimidine-5-carboxylic acid is notable for its unique structural features and potential utility in various chemical applications.
Formula:C6H5ClN2O2
InChI:InChI=1/C6H5ClN2O2/c1-3-4(5(10)11)2-8-6(7)9-3/h2H,1H3,(H,10,11)
InChI key:CUECEAQETPETQR-UHFFFAOYSA-N
SMILES:Cc1c(cnc(Cl)n1)C(=O)O
Synonyms:
  • 2-Hydroxy-4-methylpyrimidine-5-carboxylic acid
  • 5-Pyrimidinecarboxylic Acid, 2-Hydroxy-4-Methyl-
  • 6-Methyl-2-Oxo-1,2-Dihydropyrimidine-5-Carboxylic Acid
  • 2-Chloro-4-Methylpyrimidine-5-Carboxylic Acid
Found 3 products.