CAS 130348-94-6

NONANOIC-D17 ACID

Description:

Nonanoic-D17 acid, also known as nonanoic acid or pelargonic acid, is a straight-chain fatty acid characterized by its nine carbon atoms and a carboxylic acid functional group. The "D17" designation indicates that the molecule is isotopically labeled with deuterium, which is a stable isotope of hydrogen, enhancing its utility in various analytical applications, particularly in tracing and studying metabolic pathways. Nonanoic acid is typically a colorless liquid with a characteristic fatty odor and is soluble in organic solvents but has limited solubility in water. It is used in the production of esters for flavoring and fragrance applications, as well as in the synthesis of surfactants and other chemical intermediates. Additionally, nonanoic acid exhibits antimicrobial properties, making it of interest in agricultural and pharmaceutical applications. Its physical and chemical properties, such as boiling point and melting point, are influenced by the length of its carbon chain and the presence of the carboxylic acid group, which contributes to its reactivity and interactions with other substances.

Formula: C₉HD₁₇O₂

InChI: InChI=1S/C9H18O2/c1-2-3-4-5-6-7-8-9(10)11/h2-8H2,1H3,(H,10,11)/i1D3,2D2,3D2,4D2,5D2,6D2,7D2,8D2

InChI key: FBUKVWPVBMHYJY-OISRNESJSA-N

SMILES: [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O

Nonanoic acid-D17

CAS: 130348-94-6

Nonanoic acid-D17

Formula: C₉HD₁₇O₂

Purity: 98%

Molecular weight: 175.34

Ref: 54-DE2111

Nonanoic acid-D17

CAS: 130348-94-6

Nonanoic acid-D17 is the deuterated form of Nonanoic acid. Nonanoic acid (T3947) is a naturally occurring saturated fatty acid composed of nine carbon atoms. It is known to significantly reduce bacterial translocation, enhance antibacterial activity, and notably increase the secretion of porcine β-defensin 1 (pBD-1) and pBD-2.

Formula: C₉H₁₈O₂

Color and Shape: Solid

Molecular weight: 175.34

Ref: TM-TMID-0430

Nonanoic-d17 Acid

CAS: 112-05-0, 130348-94-6

Formula: CD₃(CD₂)₇COOH

Purity: 98 atom % D

Color and Shape: Colorless Liquid

Molecular weight: 175.23738

Ref: 3U-D2712

n-Nonanoic Acid-d17

Controlled Product

CAS: 130348-94-6

Formula: C₉D₁₇HO₂

Color and Shape: Neat

Molecular weight: 175.34

Ref: TR-N649388