CAS 1303993-73-8

Formula: C8H7ClNNaO3

InChI: InChI=1S/C8H8ClNO3.Na/c9-6-2-1-4(11)3-5(6)7(10)8(12)13;/h1-3,7,11H,10H2,(H,12,13);/q;+1/p-1

InChI key: KZRZZIISUUINJT-UHFFFAOYSA-M

SMILES: C1=CC(=C(C=C1O)C(C(=O)[O-])N)Cl.[Na+]

CHPG sodium salt

CAS: 1303993-73-8

CHPG sodium salt

Formula: C₈H₇ClNNaO₃

Purity: ≥98%

Molecular weight: 223.59

Ref: 54-BUP21623

CHPG (sodium salt)

CAS: 1303993-73-8

Purity: 99.17%

Ref: IN-DA009GPG

CHPG sodium salt

CAS: 1303993-73-8

CHPG sodium salt is a selective agonist of mGluR5 and activates the ERK and Akt signaling pathways.

Formula: C₈H₇ClNNaO₃

Purity: >99.99%

Color and Shape: Solid

Molecular weight: 223.59

Ref: TM-T10808