CymitQuimica logo

CAS 13041-70-8

:

4-Bromo-trans-stilbene

Description:
4-Bromo-trans-stilbene is an organic compound characterized by its structure, which features a trans configuration of the stilbene backbone, consisting of two phenyl rings connected by a double bond, with a bromine atom substituted at the para position of one of the phenyl rings. This compound is typically a solid at room temperature and exhibits a crystalline form. It is known for its potential applications in organic synthesis and materials science, particularly in the development of organic semiconductors and photonic devices. The presence of the bromine atom enhances its reactivity, making it a useful intermediate in various chemical reactions, including cross-coupling reactions. 4-Bromo-trans-stilbene is also of interest in studies related to its photophysical properties, as it can exhibit fluorescence. Safety data indicates that, like many brominated compounds, it should be handled with care due to potential toxicity and environmental concerns. Proper storage and disposal methods are essential to mitigate any risks associated with its use.
Formula:C14H11Br
InChI:InChI=1S/C14H11Br/c15-14-10-8-13(9-11-14)7-6-12-4-2-1-3-5-12/h1-11H
InChI key:ZZMMKLVIBZWGPK-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)C=CC2=CC=C(C=C2)Br
Found 5 products.