CymitQuimica logo

CAS 13041-79-7

:

4-CYANOSTILBENE

Description:
4-Cyanostilbene is an organic compound characterized by its structure, which consists of a stilbene backbone with a cyano group (-C≡N) attached to one of the phenyl rings. This compound typically appears as a crystalline solid and is known for its significant photophysical properties, including fluorescence and the ability to undergo photoisomerization. It is often utilized in various applications such as organic electronics, photonic devices, and as a fluorescent probe in biological studies. The presence of the cyano group enhances its electron-withdrawing characteristics, influencing its reactivity and solubility in different solvents. Additionally, 4-cyanostilbene can participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, making it a versatile building block in organic synthesis. Its stability under ambient conditions and its ability to form derivatives further contribute to its utility in research and industrial applications. Safety data indicates that, like many organic compounds, it should be handled with care to avoid potential health hazards.
Formula:C15H11N
InChI:InChI=1/C15H11N/c16-12-15-10-8-14(9-11-15)7-6-13-4-2-1-3-5-13/h1-11H
InChI key:WQUHPLQCUQJSQW-VOTSOKGWSA-N
SMILES:c1ccc(cc1)C=Cc1ccc(cc1)C#N
Synonyms:
  • Stilbene-4-Carbonitrile
Found 4 products.