CymitQuimica logo

CAS 13042-33-6

:

glycohyodeoxycholic acid

Description:
Glycohyodeoxycholic acid, with the CAS number 13042-33-6, is a bile acid derivative that plays a role in the digestion and absorption of fats in the intestine. It is a conjugated bile acid, formed by the conjugation of hyodeoxycholic acid with glycine. This compound is characterized by its amphipathic nature, possessing both hydrophilic and hydrophobic properties, which allows it to effectively emulsify fats and facilitate their absorption. Glycohyodeoxycholic acid is typically found in the bile of certain species and is involved in various physiological processes, including cholesterol metabolism and the regulation of lipid levels in the body. Its structure includes a steroid nucleus with hydroxyl groups that contribute to its solubility in aqueous environments. Additionally, it may have implications in research related to liver function and metabolic disorders. As with many bile acids, it can also influence gut microbiota composition and has potential therapeutic applications in conditions related to bile acid metabolism.
Formula:C26H43NO5
InChI:InChI=1/C26H43NO5/c1-15(4-7-23(30)27-14-24(31)32)18-5-6-19-17-13-22(29)21-12-16(28)8-10-26(21,3)20(17)9-11-25(18,19)2/h15-22,28-29H,4-14H2,1-3H3,(H,27,30)(H,31,32)/t15-,16-,17+,18-,19+,20+,21+,22+,25-,26-/m1/s1
InChI key:SPOIYSFQOFYOFZ-BRDORRHWSA-N
SMILES:C[C@H](CCC(=O)NCC(=O)O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2C[C@@H]([C@H]4[C@@]3(CC[C@H](C4)O)C)O)C
Synonyms:
  • Glycine, N-((3alpha,5beta,6alpha)-3,6-dihydroxy-24-oxocholan-24-yl)-
  • N-[(3alpha,5beta,6alpha)-3,6-dihydroxy-24-oxocholan-24-yl]glycine
Found 13 products.