CAS 13074-39-0
:2-Aminoadamantane
Description:
2-Aminoadamantane, also known as memantine, is a chemical compound characterized by its unique adamantane structure, which consists of a fused polycyclic framework. It features an amino group (-NH2) attached to the second carbon of the adamantane skeleton. This compound is known for its neuroprotective properties and is primarily used in the treatment of Alzheimer's disease and other neurodegenerative disorders. 2-Aminoadamantane exhibits moderate lipophilicity, allowing it to cross the blood-brain barrier effectively. Its mechanism of action involves the antagonism of N-methyl-D-aspartate (NMDA) receptors, which play a crucial role in synaptic plasticity and memory function. The compound is typically administered in its hydrochloride salt form, enhancing its solubility and bioavailability. In terms of safety, 2-Aminoadamantane has a favorable side effect profile compared to other treatments for cognitive decline, making it a valuable option in therapeutic settings. Overall, its distinctive structure and pharmacological properties contribute to its significance in medicinal chemistry and neurology.
Formula:C10H17N
InChI:InChI=1S/C10H17N/c11-10-8-2-6-1-7(4-8)5-9(10)3-6/h6-10H,1-5,11H2
InChI key:InChIKey=QZWNXXINFABALM-UHFFFAOYSA-N
SMILES:NC1C2CC3CC1CC(C2)C3
Synonyms:- (Adamantan-2-yl)amine
- 2-Adamantanamine
- 2-Adamantanamine (8CI)
- 2-Adamantaneamine
- 2-Adamantylamine
- 2-Amantadine
- Jp 60
- Nsc 127842
- Tricyclo(3.3.1.13,7)decan-2-amine (9CI)
- Tricyclo[3.3.1.1<sup>3,7</sup>]decan-2-amine
- 2-Aminoadamantane
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Tricyclo[3.3.1.13,7]decan-2-amine
CAS:Formula:C10H17NPurity:97%Color and Shape:SolidMolecular weight:151.24872-Aminoadamantane
CAS:2-Aminoadamantane is a fluorescent derivative that can be used for the preparation of samples. It has an acyl chain with a hydroxyl group at the 2 position. 2-Aminoadamantane can inhibit bacterial growth by binding to lipopolysaccharides, which are cell wall components of Gram-negative bacteria. This drug also inhibits the production of nitric oxide and prostaglandins, which are important in inflammatory and immunological responses. 2-Aminoadamantane has been shown to have locomotor activity in mice and to decrease the number of seizures in rats. Synthetic cannabinoids such as WIN 55,212-2 and CP 55,940 have been shown to bind to cannabinoid receptors and inhibit neurotransmitter release in rat hippocampal neurons in vitro.
Formula:C10H17NPurity:Min. 95%Molecular weight:151.25 g/mol




