CymitQuimica logo

CAS 131076-14-7

:

4,5-Dimethoxy-1,2-phenylenediamine dihydrochloride

Description:
4,5-Dimethoxy-1,2-phenylenediamine dihydrochloride is an organic compound characterized by its two methoxy groups attached to a phenylene diamine structure. This compound typically appears as a crystalline solid and is soluble in water due to the presence of the dihydrochloride salt form, which enhances its solubility. It is primarily used in organic synthesis and may serve as an intermediate in the production of dyes, pigments, or pharmaceuticals. The presence of the amino groups allows for various chemical reactions, including coupling reactions, making it valuable in synthetic organic chemistry. Additionally, the methoxy groups can influence the electronic properties of the molecule, potentially affecting its reactivity and interaction with other chemical species. Safety data should be consulted, as with any chemical substance, to understand its handling, storage, and potential hazards. Overall, 4,5-Dimethoxy-1,2-phenylenediamine dihydrochloride is a versatile compound with applications in various chemical fields.
Formula:C8H14Cl2N2O2
InChI:InChI=1/C8H12N2O2.2ClH/c1-11-7-3-5(9)6(10)4-8(7)12-2;;/h3-4H,9-10H2,1-2H3;2*1H
InChI key:ORAAOAMEUMZGGU-UHFFFAOYSA-N
SMILES:COc1cc(c(cc1OC)N)N.Cl.Cl
Synonyms:
  • 1,2-Diamino-4,5-dimethoxybenzene, dihydrochloride (DDB)
  • 4,5-Dimethoxybenzene-1,2-Diamine Dihydrochloride
Found 5 products.