CymitQuimica logo

CAS 131106-70-2

:

6-TRIFLUOROMETHYLBENZOTHIAZOLE

Description:
6-Trifluoromethylbenzothiazole is an organic compound characterized by the presence of a benzothiazole ring, which consists of a benzene fused to a thiazole moiety. The trifluoromethyl group (-CF3) attached to the benzothiazole significantly influences its chemical properties, enhancing its lipophilicity and potentially its biological activity. This compound is typically a solid at room temperature and is known for its stability under various conditions. It exhibits unique reactivity due to the electron-withdrawing nature of the trifluoromethyl group, which can affect its behavior in chemical reactions, such as electrophilic substitutions. Additionally, 6-trifluoromethylbenzothiazole may have applications in pharmaceuticals, agrochemicals, and materials science, owing to its distinctive structural features. Its CAS number, 131106-70-2, is a unique identifier that facilitates the tracking and regulation of this chemical in various databases and regulatory frameworks. Safety data sheets should be consulted for handling and toxicity information, as compounds with trifluoromethyl groups can exhibit varied biological effects.
Formula:C8H4F3NS
InChI:InChI=1S/C8H4F3NS/c9-8(10,11)5-1-2-6-7(3-5)13-4-12-6/h1-4H
InChI key:BULNNISVPSQIFO-UHFFFAOYSA-N
SMILES:C1=CC2=C(C=C1C(F)(F)F)SC=N2
Synonyms:
  • Benzothiazole, 6-(trifluoromethyl)- (9CI)
Found 4 products.