CAS 13115-71-4: Glycyl-L-Glutamine
Description:Glycyl-L-Glutamine, with the CAS number 13115-71-4, is a dipeptide composed of the amino acids glycine and L-glutamine. It is characterized by its role in protein synthesis and cellular metabolism. This compound is typically found in various biological systems and is known for its potential benefits in promoting gut health and enhancing immune function. Glycyl-L-Glutamine exhibits good solubility in water, making it suitable for various applications in biochemistry and nutrition. Its structure features a peptide bond between the amino group of glycine and the carboxyl group of L-glutamine, which contributes to its stability and functionality. Additionally, it may play a role in nitrogen transport and storage within the body. The substance is often studied for its therapeutic potential, particularly in conditions related to gastrointestinal health and muscle recovery. Overall, Glycyl-L-Glutamine is a significant compound in both physiological processes and potential clinical applications.
Formula:C7H13N3O4
InChI:InChI=1S/C7H13N3O4/c8-3-6(12)10-4(7(13)14)1-2-5(9)11/h4H,1-3,8H2,(H2,9,11)(H,10,12)(H,13,14)/t4-/m0/s1
InChI key:InChIKey=PNMUAGGSDZXTHX-BYPYZUCNSA-N
SMILES:O=C(N)CCC(NC(=O)CN)C(=O)O
- Synonyms:
- (2S)-2-(2-Aminoacetamido)-4-carbamoylbutanoic acid
- (2S)-5-Amino-2-[(2-azaniumylacetyl)amino]-5-oxopentanoate
- (S)-5-Amino-2-(2-aminoacetamido)-5-oxopentanoic acid
- 105: PN: EP2161028 PAGE: 10 claimed protein
- 143: PN: US20130123467 SEQID: 172 claimed protein
- 15: PN: WO2021055880 SEQID: 16 claimed protein
- 23: PN: WO2020009548 SEQID: 23 claimed protein
- <span class="text-smallcaps">L</span>-Glutamine, N<sup>2</sup>-glycyl-
- <span class="text-smallcaps">L</span>-Glutamine, glycyl-
- Glutamine, N<sup>2</sup>-glycyl-, <span class="text-smallcaps">L</span>-
- See more synonyms
- Glycyl-<span class="text-smallcaps">L</span>-glutamine
- Glycylglutamine
- Glutamine, N2-glycyl-, L-
- L-Glutamine, N2-glycyl-
- L-Glutamine, glycyl-
- Glycyl-L-glutamine
