CAS 1313584-92-7
:2-Morpholinemethanol, hydrochloride
Description:
2-Morpholinemethanol, hydrochloride is a chemical compound characterized by its morpholine ring structure, which contributes to its unique properties. As a hydrochloride salt, it is typically a white to off-white crystalline powder that is soluble in water, making it suitable for various applications in pharmaceutical and chemical research. The presence of the morpholine moiety imparts basic characteristics, allowing it to interact with various biological systems. This compound may exhibit potential as a building block in drug synthesis or as a ligand in coordination chemistry. Its hydrochloride form enhances stability and solubility, which is advantageous for formulation in aqueous environments. Additionally, it may possess biological activity, although specific pharmacological effects would depend on further studies. Safety data should be consulted to understand its handling and toxicity, as with any chemical substance. Overall, 2-Morpholinemethanol, hydrochloride is a versatile compound with potential applications in medicinal chemistry and related fields.
Formula:C5H11NO2ClH
InChI:InChI=1S/C5H11NO2.ClH/c7-4-5-3-6-1-2-8-5;/h5-7H,1-4H2;1H/t5-;/m0./s1
InChI key:NBGXGDBTUJNTKJ-JEDNCBNOSA-N
SMILES:C1CO[C@@H](CN1)CO.Cl
Synonyms:- (S)-2-Hydroxymethylmorpholine Hcl
- 2-Hydroxymethylmorpholine Hcl
- (2S)-2-Morpholinemethanol hydrochloride
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
(2S)-2-Morpholinemethanol hydrochloride
CAS:Formula:C5H12ClNO2Purity:97%Color and Shape:SolidMolecular weight:153.6073Ref: IN-DA000VZP
250gTo inquire500gTo inquire100mg20.00€250mg24.00€1g25.00€5g63.00€10g93.00€25g153.00€50g257.00€100g575.00€(2S)-Morpholin-2-ylmethanol hydrochloride
CAS:(2S)-Morpholin-2-ylmethanol hydrochlorideFormula:C5H11NO2·ClHPurity:97%Molecular weight:153.60728(S)-Morpholin-2-ylmethanol hydrochloride
CAS:(S)-Morpholin-2-ylmethanol hydrochlorideFormula:C5H12ClNO2Purity:97% ELSDMolecular weight:153.61(S)-(2-Hydroxymethyl)morpholine hydrochloride
CAS:(S)-(2-Hydroxymethyl)morpholine hydrochloride is a high-quality chemical that can be used as an intermediate to other reagents. It is a fine chemical and speciality chemical, which is useful in research and development. (S)-(2-Hydroxymethyl)morpholine hydrochloride has been used as a building block for the synthesis of various compounds, such as pharmaceuticals. It is also versatile, having been used as a reaction component in organic synthesis reactions.Formula:C5H11NO2·HClPurity:Min. 95 Area-%Color and Shape:White Off-White PowderMolecular weight:153.61 g/mol(S)-(2-Hydroxymethyl)morpholine hydrochloride
CAS:Formula:C5H12ClNO2Purity:97%Color and Shape:SolidMolecular weight:153.61




