CymitQuimica logo

CAS 131379-39-0

:

4-ETHOXY-4-OXOBUTYLZINC BROMIDE

Description:
4-Ethoxy-4-oxobutylzinc bromide is an organozinc compound characterized by its zinc center coordinated with an ethoxy and an oxobutyl group, along with a bromide ion. This compound typically exhibits properties associated with organometallics, such as reactivity towards electrophiles and nucleophiles, making it useful in various synthetic applications, particularly in organic synthesis and catalysis. The presence of the ethoxy group enhances its solubility in organic solvents, while the oxobutyl moiety can participate in further chemical transformations. As an organozinc reagent, it is often employed in cross-coupling reactions, allowing for the formation of carbon-carbon bonds. The bromide ion serves as a leaving group, facilitating these reactions. Safety considerations are important when handling this compound, as organozinc reagents can be pyrophoric and reactive with moisture. Proper storage and handling protocols should be followed to mitigate risks. Overall, 4-ethoxy-4-oxobutylzinc bromide is a valuable reagent in the toolkit of synthetic chemists for constructing complex organic molecules.
Formula:C6H11BrO2Zn
InChI:InChI=1/C6H11O2.BrH.Zn/c1-3-5-6(7)8-4-2;;/h1,3-5H2,2H3;1H;/q;;+1/p-1/rC6H11BrO2Zn/c1-2-9-6(8)4-3-5-10-7/h2-5H2,1H3
InChI key:XPARCVGSTPKNNR-UHFFFAOYSA-M
SMILES:[CH2]CCC(=O)OCC.Br.[Zn]
Found 2 products.