CymitQuimica logo

CAS 131395-29-4

:

N1-[2-bromo-4-(trifluoromethoxy)phenyl]Acetamide

Description:
N1-[2-bromo-4-(trifluoromethoxy)phenyl]acetamide, with the CAS number 131395-29-4, is a chemical compound characterized by its unique structural features, including a bromine atom and a trifluoromethoxy group attached to a phenyl ring. This compound belongs to the class of acetamides, which are derivatives of acetic acid where an amine group replaces one of the hydrogen atoms. The presence of the bromine atom contributes to its reactivity, while the trifluoromethoxy group enhances its lipophilicity and may influence its biological activity. The compound is typically used in research and development, particularly in medicinal chemistry, due to its potential as a pharmacological agent. Its molecular structure suggests it may exhibit interesting interactions with biological targets, making it a subject of interest for further studies. Safety data should be consulted for handling and usage, as halogenated compounds can pose environmental and health risks.
Formula:C9H7BrF3NO2
InChI:InChI=1S/C9H7BrF3NO2/c1-5(15)14-8-3-2-6(4-7(8)10)16-9(11,12)13/h2-4H,1H3,(H,14,15)
InChI key:ZTFDDTDGNZYFAA-UHFFFAOYSA-N
SMILES:CC(=O)NC1=C(C=C(C=C1)OC(F)(F)F)Br
Found 3 products.