CAS 131475-57-5
:Triaziflam
Description:
Triaziflam is a chemical compound classified as a herbicide, primarily used for the control of various weeds in agricultural settings. It belongs to the class of triazole compounds and is characterized by its selective action, targeting specific plant species while minimizing harm to crops. Triaziflam functions by inhibiting the biosynthesis of certain essential plant hormones, disrupting growth processes in target weeds. The compound is typically applied pre-emergence or post-emergence, depending on the specific application and target species. It is known for its low toxicity to mammals and its relatively short environmental persistence, which reduces the risk of long-term soil contamination. Triaziflam is often formulated in various ways, including granules and emulsifiable concentrates, to enhance its efficacy and ease of application. As with any chemical substance, proper handling and adherence to safety guidelines are essential to mitigate potential risks to human health and the environment.
Formula:C17H24FN5O
InChI:InChI=1S/C17H24FN5O/c1-10-6-11(2)8-13(7-10)24-9-12(3)20-16-22-14(17(4,5)18)21-15(19)23-16/h6-8,12H,9H2,1-5H3,(H3,19,20,21,22,23)
InChI key:InChIKey=IUFUITYPUYMIHI-UHFFFAOYSA-N
SMILES:N(C(COC1=CC(C)=CC(C)=C1)C)C=2N=C(C(C)(C)F)N=C(N)N2
Synonyms:- 1,3,5-Triazine-2,4-diamine, N-[2-(3,5-dimethylphenoxy)-1-methylethyl]-6-(1-fluoro-1-methylethyl)-
- 1,3,5-Triazine-2,4-diamine, N<sup>2</sup>-[2-(3,5-dimethylphenoxy)-1-methylethyl]-6-(1-fluoro-1-methylethyl)-
- 1,3,5-triazine-2,4-diamine, N2
- 131475-57-5
- Dimexyflam
- Idh 1105
- N<sup>2</sup>-[2-(3,5-Dimethylphenoxy)-1-methylethyl]-6-(1-fluoro-1-methylethyl)-1,3,5-triazine-2,4-diamine
- Triaziflam
- N2-[2-(3,5-Dimethylphenoxy)-1-methylethyl]-6-(1-fluoro-1-methylethyl)-1,3,5-triazine-2,4-diamine
- 1,3,5-Triazine-2,4-diamine, N2-[2-(3,5-dimethylphenoxy)-1-methylethyl]-6-(1-fluoro-1-methylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

